C15H19N — CID 57426056
(4aR,9aS)-N-ethyl-1,4,9,9a-tetrahydrofluoren-4a-amine (PubChem CID 57426056) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (4aR,9aS)-N-ethyl-1,4,9,9a-tetrahydrofluoren-4a-amine.
| Compound Name | (4aR,9aS)-N-ethyl-1,4,9,9a-tetrahydrofluoren-4a-amine |
|---|---|
| PubChem CID | 57426056 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (4aR,9aS)-N-ethyl-1,4,9,9a-tetrahydrofluoren-4a-amine |
| SMILES | CCN[C@]12CC=CC[C@H]1Cc1ccccc12 |
| InChI | InChI=1S/C15H19N/c1-2-16-15-10-6-5-8-13(15)11-12-7-3-4-9-14(12)15/h3-7,9,13,16H,2,8,10-11H2,1H3/t13-,15+/m0/s1 |
| InChIKey | DRCWOKJLSQUJPZ-DZGCQCFKSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|