About 4-pyridin-3-ylbenzamide
4-pyridin-3-ylbenzamide (PubChem CID 57428036) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-pyridin-3-ylbenzamide.
Molecular Properties
| Compound Name | 4-pyridin-3-ylbenzamide |
| PubChem CID | 57428036 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 4-pyridin-3-ylbenzamide |
| SMILES | NC(=O)c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C12H10N2O/c13-12(15)10-5-3-9(4-6-10)11-2-1-7-14-8-11/h1-8H,(H2,13,15) |
| InChIKey | HRWJRXNTRLZCAI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-pyridin-3-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-ylbenzamide?
The IUPAC name of 4-pyridin-3-ylbenzamide (CID 57428036) is 4-pyridin-3-ylbenzamide.
What is the SMILES notation for 4-pyridin-3-ylbenzamide?
The canonical SMILES for 4-pyridin-3-ylbenzamide is NC(=O)c1ccc(-c2cccnc2)cc1.
What is the InChIKey of 4-pyridin-3-ylbenzamide?
The InChIKey is HRWJRXNTRLZCAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c13-12(15)10-5-3-9(4-6-10)11-2-1-7-14-8-11/h1-8H,(H2,13,15).
What are the key properties of 4-pyridin-3-ylbenzamide?
4-pyridin-3-ylbenzamide has a molecular weight of 198.22 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-ylbenzamide is sourced from PubChem (CID 57428036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).