C10H14O2 — CID 57428251
(2E,6E)-2,7-dimethylocta-2,6-dien-4-yne-1,8-diol (PubChem CID 57428251) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (2E,6E)-2,7-dimethylocta-2,6-dien-4-yne-1,8-diol.
| Compound Name | (2E,6E)-2,7-dimethylocta-2,6-dien-4-yne-1,8-diol |
|---|---|
| PubChem CID | 57428251 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2E,6E)-2,7-dimethylocta-2,6-dien-4-yne-1,8-diol |
| SMILES | C/C(=C\C#C/C=C(\C)CO)CO |
| InChI | InChI=1S/C10H14O2/c1-9(7-11)5-3-4-6-10(2)8-12/h5-6,11-12H,7-8H2,1-2H3/b9-5+,10-6+ |
| InChIKey | MEAONJBNSODGKA-NXZHAISVSA-N |
| XLogP | 0.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|