About 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione
9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione (PubChem CID 57428995) has the molecular formula C12H8N2O3
and a molecular weight of 228.21 g/mol. Its IUPAC name is 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione.
Molecular Properties
| Compound Name | 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione |
| PubChem CID | 57428995 |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione |
| SMILES | O=c1[nH][nH]c(=O)c2c1ccc1ccc(O)cc12 |
| InChI | InChI=1S/C12H8N2O3/c15-7-3-1-6-2-4-8-10(9(6)5-7)12(17)14-13-11(8)16/h1-5,15H,(H,13,16)(H,14,17) |
| InChIKey | WZHGQPZFBXOWGI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione?
The IUPAC name of 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione (CID 57428995) is 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione.
What is the SMILES notation for 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione?
The canonical SMILES for 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione is O=c1[nH][nH]c(=O)c2c1ccc1ccc(O)cc12.
What is the InChIKey of 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione?
The InChIKey is WZHGQPZFBXOWGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3/c15-7-3-1-6-2-4-8-10(9(6)5-7)12(17)14-13-11(8)16/h1-5,15H,(H,13,16)(H,14,17).
What are the key properties of 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione?
9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione has a molecular weight of 228.21 g/mol, XLogP of 1.08, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-2,3-dihydrobenzo[f]phthalazine-1,4-dione is sourced from PubChem (CID 57428995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).