About 4-oxocyclohexane-1,1-dicarbonitrile
4-oxocyclohexane-1,1-dicarbonitrile (PubChem CID 57429298) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 4-oxocyclohexane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | 4-oxocyclohexane-1,1-dicarbonitrile |
| PubChem CID | 57429298 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 4-oxocyclohexane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)CCC(=O)CC1 |
| InChI | InChI=1S/C8H8N2O/c9-5-8(6-10)3-1-7(11)2-4-8/h1-4H2 |
| InChIKey | FKOGJGPVUQTDJU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxocyclohexane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxocyclohexane-1,1-dicarbonitrile?
The IUPAC name of 4-oxocyclohexane-1,1-dicarbonitrile (CID 57429298) is 4-oxocyclohexane-1,1-dicarbonitrile.
What is the SMILES notation for 4-oxocyclohexane-1,1-dicarbonitrile?
The canonical SMILES for 4-oxocyclohexane-1,1-dicarbonitrile is N#CC1(C#N)CCC(=O)CC1.
What is the InChIKey of 4-oxocyclohexane-1,1-dicarbonitrile?
The InChIKey is FKOGJGPVUQTDJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c9-5-8(6-10)3-1-7(11)2-4-8/h1-4H2.
What are the key properties of 4-oxocyclohexane-1,1-dicarbonitrile?
4-oxocyclohexane-1,1-dicarbonitrile has a molecular weight of 148.16 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxocyclohexane-1,1-dicarbonitrile is sourced from PubChem (CID 57429298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).