About 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid
4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid (PubChem CID 57429611) has the molecular formula C23H22N6O4
and a molecular weight of 446.47 g/mol. Its IUPAC name is 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid |
| PubChem CID | 57429611 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cnn(CC#Cc4ccc(C(=O)O)cc4)c3)nc2n(CC)c1=O |
| InChI | InChI=1S/C23H22N6O4/c1-3-11-29-21(30)18-20(28(4-2)23(29)33)26-19(25-18)17-13-24-27(14-17)12-5-6-15-7-9-16(10-8-15)22(31)32/h7-10,13-14H,3-4,11-12H2,1-2H3,(H,25,26)(H,31,32) |
| InChIKey | LKOJYPPWPWMHCL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid?
The IUPAC name of 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid (CID 57429611) is 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid.
What is the SMILES notation for 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid?
The canonical SMILES for 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid is CCCn1c(=O)c2[nH]c(-c3cnn(CC#Cc4ccc(C(=O)O)cc4)c3)nc2n(CC)c1=O.
What is the InChIKey of 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid?
The InChIKey is LKOJYPPWPWMHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N6O4/c1-3-11-29-21(30)18-20(28(4-2)23(29)33)26-19(25-18)17-13-24-27(14-17)12-5-6-15-7-9-16(10-8-15)22(31)32/h7-10,13-14H,3-4,11-12H2,1-2H3,(H,25,26)(H,31,32).
What are the key properties of 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid?
4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid has a molecular weight of 446.47 g/mol, XLogP of 1.93, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-(3-ethyl-2,6-dioxo-1-propyl-7H-purin-8-yl)pyrazol-1-yl]prop-1-ynyl]benzoic acid is sourced from PubChem (CID 57429611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).