C11H17NO4 — CID 57429701
8-azabicyclo[4.3.1]decane-8,10-dicarboxylic acid (PubChem CID 57429701) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 8-azabicyclo[4.3.1]decane-8,10-dicarboxylic acid.
| Compound Name | 8-azabicyclo[4.3.1]decane-8,10-dicarboxylic acid |
|---|---|
| PubChem CID | 57429701 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 8-azabicyclo[4.3.1]decane-8,10-dicarboxylic acid |
| SMILES | O=C(O)C1C2CCCCC1CN(C(=O)O)C2 |
| InChI | InChI=1S/C11H17NO4/c13-10(14)9-7-3-1-2-4-8(9)6-12(5-7)11(15)16/h7-9H,1-6H2,(H,13,14)(H,15,16) |
| InChIKey | VISVLLBWLAZURZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |