C29H48N4O2 — CID 57429930
(E)-3-[1-[2-[bis(3,3-dimethylbutyl)amino]ethyl]-2-(2,2-dimethylpropyl)benzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 57429930) has the molecular formula C29H48N4O2 and a molecular weight of 484.73 g/mol. Its IUPAC name is (E)-3-[1-[2-[bis(3,3-dimethylbutyl)amino]ethyl]-2-(2,2-dimethylpropyl)benzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[1-[2-[bis(3,3-dimethylbutyl)amino]ethyl]-2-(2,2-dimethylpropyl)benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 57429930 |
| Molecular Formula | C29H48N4O2 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.38 |
| IUPAC Name | (E)-3-[1-[2-[bis(3,3-dimethylbutyl)amino]ethyl]-2-(2,2-dimethylpropyl)benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | CC(C)(C)CCN(CCn1c(CC(C)(C)C)nc2cc(/C=C/C(=O)NO)ccc21)CCC(C)(C)C |
| InChI | InChI=1S/C29H48N4O2/c1-27(2,3)14-16-32(17-15-28(4,5)6)18-19-33-24-12-10-22(11-13-26(34)31-35)20-23(24)30-25(33)21-29(7,8)9/h10-13,20,35H,14-19,21H2,1-9H3,(H,31,34)/b13-11+ |
| InChIKey | KVPHBSJWELUXJB-ACCUITESSA-N |
| XLogP | 6.32 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|