About 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride
3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride (PubChem CID 57429985) has the molecular formula C8H19ClN4
and a molecular weight of 206.72 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride.
Molecular Properties
| Compound Name | 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride |
| PubChem CID | 57429985 |
| Molecular Formula | C8H19ClN4 |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride |
| SMILES | CCN=C=NCCC(NC)NC.Cl |
| InChI | InChI=1S/C8H18N4.ClH/c1-4-11-7-12-6-5-8(9-2)10-3;/h8-10H,4-6H2,1-3H3;1H |
| InChIKey | LZTJXGNPPQWOHG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride?
The IUPAC name of 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride (CID 57429985) is 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride.
What is the SMILES notation for 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride?
The canonical SMILES for 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride is CCN=C=NCCC(NC)NC.Cl.
What is the InChIKey of 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride?
The InChIKey is LZTJXGNPPQWOHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4.ClH/c1-4-11-7-12-6-5-8(9-2)10-3;/h8-10H,4-6H2,1-3H3;1H.
What are the key properties of 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride?
3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride has a molecular weight of 206.72 g/mol, XLogP of 0.76, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethyliminomethylideneamino)-1-N,1-N'-dimethylpropane-1,1-diamine;hydrochloride is sourced from PubChem (CID 57429985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).