C22H29NO5S2 — CID 57430364
5-(4-tert-butylphenyl)sulfonyl-2-methyl-N-(oxan-4-yl)benzenesulfonamide (PubChem CID 57430364) has the molecular formula C22H29NO5S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)sulfonyl-2-methyl-N-(oxan-4-yl)benzenesulfonamide.
| Compound Name | 5-(4-tert-butylphenyl)sulfonyl-2-methyl-N-(oxan-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 57430364 |
| Molecular Formula | C22H29NO5S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 5-(4-tert-butylphenyl)sulfonyl-2-methyl-N-(oxan-4-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1S(=O)(=O)NC1CCOCC1 |
| InChI | InChI=1S/C22H29NO5S2/c1-16-5-8-20(15-21(16)30(26,27)23-18-11-13-28-14-12-18)29(24,25)19-9-6-17(7-10-19)22(2,3)4/h5-10,15,18,23H,11-14H2,1-4H3 |
| InChIKey | IKDJQGMVODETTL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |