About 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene
1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene (PubChem CID 57430787) has the molecular formula C14H13BrO2S
and a molecular weight of 325.23 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene |
| PubChem CID | 57430787 |
| Molecular Formula | C14H13BrO2S |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccccc2)c(C)c1Br |
| InChI | InChI=1S/C14H13BrO2S/c1-10-8-9-13(11(2)14(10)15)18(16,17)12-6-4-3-5-7-12/h3-9H,1-2H3 |
| InChIKey | CFIOWYKBOYJVCT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene?
The IUPAC name of 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene (CID 57430787) is 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene.
What is the SMILES notation for 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene?
The canonical SMILES for 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene is Cc1ccc(S(=O)(=O)c2ccccc2)c(C)c1Br.
What is the InChIKey of 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene?
The InChIKey is CFIOWYKBOYJVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrO2S/c1-10-8-9-13(11(2)14(10)15)18(16,17)12-6-4-3-5-7-12/h3-9H,1-2H3.
What are the key properties of 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene?
1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene has a molecular weight of 325.23 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3-bromo-2,4-dimethylbenzene is sourced from PubChem (CID 57430787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).