2,5-dichlorothiophene-3-sulfonyl fluoride

C4HCl2FO2S2 — CID 57430790

IUPAC2,5-dichlorothiophene-3-sulfonyl fluoride
SMILESO=S(=O)(F)c1cc(Cl)sc1Cl
InChIInChI=1S/C4HCl2FO2S2/c5-3-1-2(4(6)10-3)11(7,8)9/h1H
InChIKeyABNWXJBSROUHKZ-UHFFFAOYSA-N
MW235.09 g/mol
LogP2.71
Rot. Bonds1

About 2,5-dichlorothiophene-3-sulfonyl fluoride

2,5-dichlorothiophene-3-sulfonyl fluoride (PubChem CID 57430790) has the molecular formula C4HCl2FO2S2 and a molecular weight of 235.09 g/mol. Its IUPAC name is 2,5-dichlorothiophene-3-sulfonyl fluoride.

Molecular Properties

Compound Name2,5-dichlorothiophene-3-sulfonyl fluoride
PubChem CID57430790
Molecular FormulaC4HCl2FO2S2
Molecular Weight235.09 g/mol
Exact Mass233.88
IUPAC Name2,5-dichlorothiophene-3-sulfonyl fluoride
SMILESO=S(=O)(F)c1cc(Cl)sc1Cl
InChIInChI=1S/C4HCl2FO2S2/c5-3-1-2(4(6)10-3)11(7,8)9/h1H
InChIKeyABNWXJBSROUHKZ-UHFFFAOYSA-N
XLogP2.71
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.09
LogP ≤ 52.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2,5-dichlorothiophene-3-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-Chlorothiophene-2-Sulfonamide
CID 1241301
3-Thiophenesulfonamide, 2,5-dichloro-
CID 2799888
4,5-Dichlorothiophene-2-sulfonyl chloride
CID 518622
5-Chlorothiophene-2-sulfonyl chloride
CID 2733925
2,5-Dichlorothiophene-3-sulfonyl chloride
CID 2736094
4,5-Dichlorothiophene-2-sulfonamide
CID 3722094
3-Chlorothiophene-2-sulfonyl chloride
CID 54346504
3-Bromo-5-chlorothiophene-2-sulfonyl chloride
CID 2737400
2-Chloro-5-methanesulfonylthiophene
CID 21340881
2-Chlorothiophene-3-sulfonyl chloride
CID 21666744
Sodium 2,5-dichlorothiophene-3-sulfinate
CID 23683335
3,5-Dichlorothiophene-2-sulfonyl chloride
CID 85570396

Frequently Asked Questions

What is the IUPAC name of 2,5-dichlorothiophene-3-sulfonyl fluoride?
The IUPAC name of 2,5-dichlorothiophene-3-sulfonyl fluoride (CID 57430790) is 2,5-dichlorothiophene-3-sulfonyl fluoride.
What is the SMILES notation for 2,5-dichlorothiophene-3-sulfonyl fluoride?
The canonical SMILES for 2,5-dichlorothiophene-3-sulfonyl fluoride is O=S(=O)(F)c1cc(Cl)sc1Cl.
What is the InChIKey of 2,5-dichlorothiophene-3-sulfonyl fluoride?
The InChIKey is ABNWXJBSROUHKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HCl2FO2S2/c5-3-1-2(4(6)10-3)11(7,8)9/h1H.
What are the key properties of 2,5-dichlorothiophene-3-sulfonyl fluoride?
2,5-dichlorothiophene-3-sulfonyl fluoride has a molecular weight of 235.09 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichlorothiophene-3-sulfonyl fluoride is sourced from PubChem (CID 57430790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).