About 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol
7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol (PubChem CID 57430873) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol.
Molecular Properties
| Compound Name | 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol |
| PubChem CID | 57430873 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol |
| SMILES | Cc1cc(O)c2c(c1)C=CC(C)(c1ccoc1)C2 |
| InChI | InChI=1S/C16H16O2/c1-11-7-12-3-5-16(2,13-4-6-18-10-13)9-14(12)15(17)8-11/h3-8,10,17H,9H2,1-2H3 |
| InChIKey | BGRYWKAFCHHCHM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol?
The IUPAC name of 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol (CID 57430873) is 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol.
What is the SMILES notation for 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol?
The canonical SMILES for 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol is Cc1cc(O)c2c(c1)C=CC(C)(c1ccoc1)C2.
What is the InChIKey of 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol?
The InChIKey is BGRYWKAFCHHCHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2/c1-11-7-12-3-5-16(2,13-4-6-18-10-13)9-14(12)15(17)8-11/h3-8,10,17H,9H2,1-2H3.
What are the key properties of 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol?
7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol has a molecular weight of 240.30 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(furan-3-yl)-3,7-dimethyl-8H-naphthalen-1-ol is sourced from PubChem (CID 57430873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).