C6H8ClF3N4 — CID 57431052
3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-ium chloride (PubChem CID 57431052) has the molecular formula C6H8ClF3N4 and a molecular weight of 228.60 g/mol. Its IUPAC name is 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-ium chloride.
| Compound Name | 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-ium chloride |
|---|---|
| PubChem CID | 57431052 |
| Molecular Formula | C6H8ClF3N4 |
| Molecular Weight | 228.60 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-ium chloride |
| SMILES | FC(F)(F)c1nnc2n1CC[NH2+]C2.[Cl-] |
| InChI | InChI=1S/C6H7F3N4.ClH/c7-6(8,9)5-12-11-4-3-10-1-2-13(4)5;/h10H,1-3H2;1H |
| InChIKey | AQCSCRYRCRORET-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.60 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |