About methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate
methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate (PubChem CID 57431293) has the molecular formula C23H22N2O3S
and a molecular weight of 406.51 g/mol. Its IUPAC name is methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate |
| PubChem CID | 57431293 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(-n2cnc3cc(C)c(C)cc32)cc1OCc1ccccc1C |
| InChI | InChI=1S/C23H22N2O3S/c1-14-7-5-6-8-17(14)12-28-20-11-21(29-22(20)23(26)27-4)25-13-24-18-9-15(2)16(3)10-19(18)25/h5-11,13H,12H2,1-4H3 |
| InChIKey | KSRMQTIAIFWCHS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate?
The IUPAC name of methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate (CID 57431293) is methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate is COC(=O)c1sc(-n2cnc3cc(C)c(C)cc32)cc1OCc1ccccc1C.
What is the InChIKey of methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate?
The InChIKey is KSRMQTIAIFWCHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O3S/c1-14-7-5-6-8-17(14)12-28-20-11-21(29-22(20)23(26)27-4)25-13-24-18-9-15(2)16(3)10-19(18)25/h5-11,13H,12H2,1-4H3.
What are the key properties of methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate?
methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate has a molecular weight of 406.51 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(5,6-dimethylbenzimidazol-1-yl)-3-[(2-methylphenyl)methoxy]thiophene-2-carboxylate is sourced from PubChem (CID 57431293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).