C25H27FN2O3 — CID 57431679
methyl (6R)-9-[(3-fluorophenyl)methyl]-6-(2-methylpropanoylamino)-5,6,7,8-tetrahydrocarbazole-3-carboxylate (PubChem CID 57431679) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is methyl (6R)-9-[(3-fluorophenyl)methyl]-6-(2-methylpropanoylamino)-5,6,7,8-tetrahydrocarbazole-3-carboxylate.
| Compound Name | methyl (6R)-9-[(3-fluorophenyl)methyl]-6-(2-methylpropanoylamino)-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 57431679 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | methyl (6R)-9-[(3-fluorophenyl)methyl]-6-(2-methylpropanoylamino)-5,6,7,8-tetrahydrocarbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)c1c(n2Cc2cccc(F)c2)CC[C@@H](NC(=O)C(C)C)C1 |
| InChI | InChI=1S/C25H27FN2O3/c1-15(2)24(29)27-19-8-10-23-21(13-19)20-12-17(25(30)31-3)7-9-22(20)28(23)14-16-5-4-6-18(26)11-16/h4-7,9,11-12,15,19H,8,10,13-14H2,1-3H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | UPWDJXZQYTUDMX-LJQANCHMSA-N |
| XLogP | 4.24 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|