About 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one
4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one (PubChem CID 57431800) has the molecular formula C29H29N5O
and a molecular weight of 463.59 g/mol. Its IUPAC name is 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one |
| PubChem CID | 57431800 |
| Molecular Formula | C29H29N5O |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one |
| SMILES | CC(C)N1Cc2c(NC(c3ccccc3)c3ccccc3)nc(NCc3ccccc3)nc2C1=O |
| InChI | InChI=1S/C29H29N5O/c1-20(2)34-19-24-26(28(34)35)32-29(30-18-21-12-6-3-7-13-21)33-27(24)31-25(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,20,25H,18-19H2,1-2H3,(H2,30,31,32,33) |
| InChIKey | ALIQSESGGWAGQX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one?
The IUPAC name of 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one (CID 57431800) is 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one.
What is the SMILES notation for 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one?
The canonical SMILES for 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one is CC(C)N1Cc2c(NC(c3ccccc3)c3ccccc3)nc(NCc3ccccc3)nc2C1=O.
What is the InChIKey of 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one?
The InChIKey is ALIQSESGGWAGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29N5O/c1-20(2)34-19-24-26(28(34)35)32-29(30-18-21-12-6-3-7-13-21)33-27(24)31-25(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,20,25H,18-19H2,1-2H3,(H2,30,31,32,33).
What are the key properties of 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one?
4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one has a molecular weight of 463.59 g/mol, XLogP of 5.65, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzhydrylamino)-2-(benzylamino)-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-7-one is sourced from PubChem (CID 57431800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).