About 4H-[1,3]thiazolo[4,5-c]azepine
4H-[1,3]thiazolo[4,5-c]azepine (PubChem CID 57432535) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 4H-[1,3]thiazolo[4,5-c]azepine.
Molecular Properties
| Compound Name | 4H-[1,3]thiazolo[4,5-c]azepine |
| PubChem CID | 57432535 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 4H-[1,3]thiazolo[4,5-c]azepine |
| SMILES | C1=Cc2scnc2CN=C1 |
| InChI | InChI=1S/C7H6N2S/c1-2-7-6(4-8-3-1)9-5-10-7/h1-3,5H,4H2 |
| InChIKey | TVDJMXGINUJARP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-[1,3]thiazolo[4,5-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-[1,3]thiazolo[4,5-c]azepine?
The IUPAC name of 4H-[1,3]thiazolo[4,5-c]azepine (CID 57432535) is 4H-[1,3]thiazolo[4,5-c]azepine.
What is the SMILES notation for 4H-[1,3]thiazolo[4,5-c]azepine?
The canonical SMILES for 4H-[1,3]thiazolo[4,5-c]azepine is C1=Cc2scnc2CN=C1.
What is the InChIKey of 4H-[1,3]thiazolo[4,5-c]azepine?
The InChIKey is TVDJMXGINUJARP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c1-2-7-6(4-8-3-1)9-5-10-7/h1-3,5H,4H2.
What are the key properties of 4H-[1,3]thiazolo[4,5-c]azepine?
4H-[1,3]thiazolo[4,5-c]azepine has a molecular weight of 150.21 g/mol, XLogP of 1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-[1,3]thiazolo[4,5-c]azepine is sourced from PubChem (CID 57432535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).