About 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one
6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one (PubChem CID 57432940) has the molecular formula C17H16F2N4O
and a molecular weight of 330.34 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one.
Molecular Properties
| Compound Name | 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one |
| PubChem CID | 57432940 |
| Molecular Formula | C17H16F2N4O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one |
| SMILES | CC(C)Cn1c(-c2c(F)cccc2F)cnc(-n2cccn2)c1=O |
| InChI | InChI=1S/C17H16F2N4O/c1-11(2)10-22-14(15-12(18)5-3-6-13(15)19)9-20-16(17(22)24)23-8-4-7-21-23/h3-9,11H,10H2,1-2H3 |
| InChIKey | JZLWCGAPVJCTOI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one?
The IUPAC name of 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one (CID 57432940) is 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one.
What is the SMILES notation for 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one?
The canonical SMILES for 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one is CC(C)Cn1c(-c2c(F)cccc2F)cnc(-n2cccn2)c1=O.
What is the InChIKey of 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one?
The InChIKey is JZLWCGAPVJCTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2N4O/c1-11(2)10-22-14(15-12(18)5-3-6-13(15)19)9-20-16(17(22)24)23-8-4-7-21-23/h3-9,11H,10H2,1-2H3.
What are the key properties of 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one?
6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one has a molecular weight of 330.34 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-difluorophenyl)-1-(2-methylpropyl)-3-pyrazol-1-ylpyrazin-2-one is sourced from PubChem (CID 57432940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).