About 3-benzyl-2,2-dimethylimidazolidin-4-one
3-benzyl-2,2-dimethylimidazolidin-4-one (PubChem CID 57433089) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-benzyl-2,2-dimethylimidazolidin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-2,2-dimethylimidazolidin-4-one |
| PubChem CID | 57433089 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-benzyl-2,2-dimethylimidazolidin-4-one |
| SMILES | CC1(C)NCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C12H16N2O/c1-12(2)13-8-11(15)14(12)9-10-6-4-3-5-7-10/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | PKHOFVIMUGPCRI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-2,2-dimethylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2,2-dimethylimidazolidin-4-one?
The IUPAC name of 3-benzyl-2,2-dimethylimidazolidin-4-one (CID 57433089) is 3-benzyl-2,2-dimethylimidazolidin-4-one.
What is the SMILES notation for 3-benzyl-2,2-dimethylimidazolidin-4-one?
The canonical SMILES for 3-benzyl-2,2-dimethylimidazolidin-4-one is CC1(C)NCC(=O)N1Cc1ccccc1.
What is the InChIKey of 3-benzyl-2,2-dimethylimidazolidin-4-one?
The InChIKey is PKHOFVIMUGPCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-12(2)13-8-11(15)14(12)9-10-6-4-3-5-7-10/h3-7,13H,8-9H2,1-2H3.
What are the key properties of 3-benzyl-2,2-dimethylimidazolidin-4-one?
3-benzyl-2,2-dimethylimidazolidin-4-one has a molecular weight of 204.27 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2,2-dimethylimidazolidin-4-one is sourced from PubChem (CID 57433089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).