About 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate
2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 57434267) has the molecular formula C16H16N2O3S2
and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate.
Molecular Properties
| Compound Name | 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate |
| PubChem CID | 57434267 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | Cc1nccn1CCOC(=O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H16N2O3S2/c1-12-17-6-7-18(12)8-9-21-15(19)16(20,13-4-2-10-22-13)14-5-3-11-23-14/h2-7,10-11,20H,8-9H2,1H3 |
| InChIKey | AHAPBXUYSKXBHC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate?
The IUPAC name of 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate (CID 57434267) is 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate.
What is the SMILES notation for 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate?
The canonical SMILES for 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate is Cc1nccn1CCOC(=O)C(O)(c1cccs1)c1cccs1.
What is the InChIKey of 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate?
The InChIKey is AHAPBXUYSKXBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3S2/c1-12-17-6-7-18(12)8-9-21-15(19)16(20,13-4-2-10-22-13)14-5-3-11-23-14/h2-7,10-11,20H,8-9H2,1H3.
What are the key properties of 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate?
2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate has a molecular weight of 348.45 g/mol, XLogP of 2.79, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylimidazol-1-yl)ethyl 2-hydroxy-2,2-dithiophen-2-ylacetate is sourced from PubChem (CID 57434267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).