C27H27F2N5O3 — CID 57434643
3-[2-[3-(diethylamino)propylamino]-8-(2,6-difluorophenyl)-7-oxopyrido[2,3-d]pyrimidin-4-yl]benzoic acid (PubChem CID 57434643) has the molecular formula C27H27F2N5O3 and a molecular weight of 507.54 g/mol. Its IUPAC name is 3-[2-[3-(diethylamino)propylamino]-8-(2,6-difluorophenyl)-7-oxopyrido[2,3-d]pyrimidin-4-yl]benzoic acid.
| Compound Name | 3-[2-[3-(diethylamino)propylamino]-8-(2,6-difluorophenyl)-7-oxopyrido[2,3-d]pyrimidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 57434643 |
| Molecular Formula | C27H27F2N5O3 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 3-[2-[3-(diethylamino)propylamino]-8-(2,6-difluorophenyl)-7-oxopyrido[2,3-d]pyrimidin-4-yl]benzoic acid |
| SMILES | CCN(CC)CCCNc1nc(-c2cccc(C(=O)O)c2)c2ccc(=O)n(-c3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C27H27F2N5O3/c1-3-33(4-2)15-7-14-30-27-31-23(17-8-5-9-18(16-17)26(36)37)19-12-13-22(35)34(25(19)32-27)24-20(28)10-6-11-21(24)29/h5-6,8-13,16H,3-4,7,14-15H2,1-2H3,(H,36,37)(H,30,31,32) |
| InChIKey | ZEBGVXFSIYFORF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|