About 4,5-dioctyl-2H-triazole
4,5-dioctyl-2H-triazole (PubChem CID 57434747) has the molecular formula C18H35N3
and a molecular weight of 293.50 g/mol. Its IUPAC name is 4,5-dioctyl-2H-triazole.
Molecular Properties
| Compound Name | 4,5-dioctyl-2H-triazole |
| PubChem CID | 57434747 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 4,5-dioctyl-2H-triazole |
| SMILES | CCCCCCCCc1n[nH]nc1CCCCCCCC |
| InChI | InChI=1S/C18H35N3/c1-3-5-7-9-11-13-15-17-18(20-21-19-17)16-14-12-10-8-6-4-2/h3-16H2,1-2H3,(H,19,20,21) |
| InChIKey | YKFCGFDCJNZOJV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dioctyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dioctyl-2H-triazole?
The IUPAC name of 4,5-dioctyl-2H-triazole (CID 57434747) is 4,5-dioctyl-2H-triazole.
What is the SMILES notation for 4,5-dioctyl-2H-triazole?
The canonical SMILES for 4,5-dioctyl-2H-triazole is CCCCCCCCc1n[nH]nc1CCCCCCCC.
What is the InChIKey of 4,5-dioctyl-2H-triazole?
The InChIKey is YKFCGFDCJNZOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N3/c1-3-5-7-9-11-13-15-17-18(20-21-19-17)16-14-12-10-8-6-4-2/h3-16H2,1-2H3,(H,19,20,21).
What are the key properties of 4,5-dioctyl-2H-triazole?
4,5-dioctyl-2H-triazole has a molecular weight of 293.50 g/mol, XLogP of 5.61, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dioctyl-2H-triazole is sourced from PubChem (CID 57434747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).