C21H30O3 — CID 57434787
9-hydroxy-7-(2-methyloctan-2-yl)-2,3,4a,9b-tetrahydro-1H-dibenzofuran-4-one (PubChem CID 57434787) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 9-hydroxy-7-(2-methyloctan-2-yl)-2,3,4a,9b-tetrahydro-1H-dibenzofuran-4-one.
| Compound Name | 9-hydroxy-7-(2-methyloctan-2-yl)-2,3,4a,9b-tetrahydro-1H-dibenzofuran-4-one |
|---|---|
| PubChem CID | 57434787 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 9-hydroxy-7-(2-methyloctan-2-yl)-2,3,4a,9b-tetrahydro-1H-dibenzofuran-4-one |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC1C(=O)CCCC21 |
| InChI | InChI=1S/C21H30O3/c1-4-5-6-7-11-21(2,3)14-12-17(23)19-15-9-8-10-16(22)20(15)24-18(19)13-14/h12-13,15,20,23H,4-11H2,1-3H3 |
| InChIKey | HNFUQJZHJZSOHA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|