C27H20F6N4O2S — CID 57434822
N-cyclopropyl-N-[[5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorophenyl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 57434822) has the molecular formula C27H20F6N4O2S and a molecular weight of 578.54 g/mol. Its IUPAC name is N-cyclopropyl-N-[[5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorophenyl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-cyclopropyl-N-[[5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorophenyl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 57434822 |
| Molecular Formula | C27H20F6N4O2S |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | N-cyclopropyl-N-[[5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorophenyl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1F)N(Cc1cc(-c2ccc3ncnc(NC4CC4)c3c2)ccc1F)C1CC1 |
| InChI | InChI=1S/C27H20F6N4O2S/c28-19-7-1-13(14-2-8-20-18(10-14)27(35-12-34-20)36-16-3-4-16)9-15(19)11-37(17-5-6-17)40(38,39)26-24(32)22(30)21(29)23(31)25(26)33/h1-2,7-10,12,16-17H,3-6,11H2,(H,34,35,36) |
| InChIKey | WYMBMKDVCLVBRJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|