C18H14FN3O — CID 57435174
5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorobenzaldehyde (PubChem CID 57435174) has the molecular formula C18H14FN3O and a molecular weight of 307.33 g/mol. Its IUPAC name is 5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorobenzaldehyde.
| Compound Name | 5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorobenzaldehyde |
|---|---|
| PubChem CID | 57435174 |
| Molecular Formula | C18H14FN3O |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 5-[4-(cyclopropylamino)quinazolin-6-yl]-2-fluorobenzaldehyde |
| SMILES | O=Cc1cc(-c2ccc3ncnc(NC4CC4)c3c2)ccc1F |
| InChI | InChI=1S/C18H14FN3O/c19-16-5-1-11(7-13(16)9-23)12-2-6-17-15(8-12)18(21-10-20-17)22-14-3-4-14/h1-2,5-10,14H,3-4H2,(H,20,21,22) |
| InChIKey | ZKQSFKOLHUFPDS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|