About methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate
methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate (PubChem CID 57435286) has the molecular formula C16H14Br2FNO3
and a molecular weight of 447.10 g/mol. Its IUPAC name is methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate.
Molecular Properties
| Compound Name | methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate |
| PubChem CID | 57435286 |
| Molecular Formula | C16H14Br2FNO3 |
| Molecular Weight | 447.10 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate |
| SMILES | COC(=O)C(F)Cc1cc(Br)c(Oc2ccc(N)cc2)c(Br)c1 |
| InChI | InChI=1S/C16H14Br2FNO3/c1-22-16(21)14(19)8-9-6-12(17)15(13(18)7-9)23-11-4-2-10(20)3-5-11/h2-7,14H,8,20H2,1H3 |
| InChIKey | BQJVOTIAFRFMMN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.10 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate?
The IUPAC name of methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate (CID 57435286) is methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate.
What is the SMILES notation for methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate?
The canonical SMILES for methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate is COC(=O)C(F)Cc1cc(Br)c(Oc2ccc(N)cc2)c(Br)c1.
What is the InChIKey of methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate?
The InChIKey is BQJVOTIAFRFMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Br2FNO3/c1-22-16(21)14(19)8-9-6-12(17)15(13(18)7-9)23-11-4-2-10(20)3-5-11/h2-7,14H,8,20H2,1H3.
What are the key properties of methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate?
methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate has a molecular weight of 447.10 g/mol, XLogP of 4.64, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(4-aminophenoxy)-3,5-dibromophenyl]-2-fluoropropanoate is sourced from PubChem (CID 57435286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).