About 1H-pyrrole-3-carboxamide;hydrochloride
1H-pyrrole-3-carboxamide;hydrochloride (PubChem CID 57435535) has the molecular formula C5H7ClN2O
and a molecular weight of 146.58 g/mol. Its IUPAC name is 1H-pyrrole-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 1H-pyrrole-3-carboxamide;hydrochloride |
| PubChem CID | 57435535 |
| Molecular Formula | C5H7ClN2O |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 1H-pyrrole-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C5H6N2O.ClH/c6-5(8)4-1-2-7-3-4;/h1-3,7H,(H2,6,8);1H |
| InChIKey | TTXOHSURMRJLRU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-pyrrole-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-3-carboxamide;hydrochloride?
The IUPAC name of 1H-pyrrole-3-carboxamide;hydrochloride (CID 57435535) is 1H-pyrrole-3-carboxamide;hydrochloride.
What is the SMILES notation for 1H-pyrrole-3-carboxamide;hydrochloride?
The canonical SMILES for 1H-pyrrole-3-carboxamide;hydrochloride is Cl.NC(=O)c1cc[nH]c1.
What is the InChIKey of 1H-pyrrole-3-carboxamide;hydrochloride?
The InChIKey is TTXOHSURMRJLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.ClH/c6-5(8)4-1-2-7-3-4;/h1-3,7H,(H2,6,8);1H.
What are the key properties of 1H-pyrrole-3-carboxamide;hydrochloride?
1H-pyrrole-3-carboxamide;hydrochloride has a molecular weight of 146.58 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-3-carboxamide;hydrochloride is sourced from PubChem (CID 57435535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).