C16H19N5O3S3 — CID 57436405
N-[5-[3-(1,2-benzothiazol-3-ylamino)propylsulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 57436405) has the molecular formula C16H19N5O3S3 and a molecular weight of 425.56 g/mol. Its IUPAC name is N-[5-[3-(1,2-benzothiazol-3-ylamino)propylsulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[3-(1,2-benzothiazol-3-ylamino)propylsulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 57436405 |
| Molecular Formula | C16H19N5O3S3 |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-[5-[3-(1,2-benzothiazol-3-ylamino)propylsulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(S(=O)(=O)NCCCNc2nsc3ccccc23)s1 |
| InChI | InChI=1S/C16H19N5O3S3/c1-10-15(25-16(19-10)20-11(2)22)27(23,24)18-9-5-8-17-14-12-6-3-4-7-13(12)26-21-14/h3-4,6-7,18H,5,8-9H2,1-2H3,(H,17,21)(H,19,20,22) |
| InChIKey | FYNSCGRTWXROBC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|