About 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide
6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide (PubChem CID 57436483) has the molecular formula C19H18N4O2S
and a molecular weight of 366.45 g/mol. Its IUPAC name is 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide |
| PubChem CID | 57436483 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide |
| SMILES | Nc1ccc2cc(C(=O)NCCCNc3nsc4ccccc34)oc2c1 |
| InChI | InChI=1S/C19H18N4O2S/c20-13-7-6-12-10-16(25-15(12)11-13)19(24)22-9-3-8-21-18-14-4-1-2-5-17(14)26-23-18/h1-2,4-7,10-11H,3,8-9,20H2,(H,21,23)(H,22,24) |
| InChIKey | MGVIVTPOQONLSX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide?
The IUPAC name of 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide (CID 57436483) is 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide.
What is the SMILES notation for 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide?
The canonical SMILES for 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide is Nc1ccc2cc(C(=O)NCCCNc3nsc4ccccc34)oc2c1.
What is the InChIKey of 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide?
The InChIKey is MGVIVTPOQONLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2S/c20-13-7-6-12-10-16(25-15(12)11-13)19(24)22-9-3-8-21-18-14-4-1-2-5-17(14)26-23-18/h1-2,4-7,10-11H,3,8-9,20H2,(H,21,23)(H,22,24).
What are the key properties of 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide?
6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide has a molecular weight of 366.45 g/mol, XLogP of 3.86, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[3-(1,2-benzothiazol-3-ylamino)propyl]-1-benzofuran-2-carboxamide is sourced from PubChem (CID 57436483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).