C24H26N4O3S — CID 57436486
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(pentanoylamino)-1-benzofuran-2-carboxamide (PubChem CID 57436486) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(pentanoylamino)-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(pentanoylamino)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 57436486 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(pentanoylamino)-1-benzofuran-2-carboxamide |
| SMILES | CCCCC(=O)Nc1ccc2oc(C(=O)NCCCNc3nsc4ccccc34)cc2c1 |
| InChI | InChI=1S/C24H26N4O3S/c1-2-3-9-22(29)27-17-10-11-19-16(14-17)15-20(31-19)24(30)26-13-6-12-25-23-18-7-4-5-8-21(18)32-28-23/h4-5,7-8,10-11,14-15H,2-3,6,9,12-13H2,1H3,(H,25,28)(H,26,30)(H,27,29) |
| InChIKey | STIFMNDXVBSRKM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|