About N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide (PubChem CID 57436491) has the molecular formula C21H18ClN3O2S
and a molecular weight of 411.91 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide |
| PubChem CID | 57436491 |
| Molecular Formula | C21H18ClN3O2S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NCCCNc1nsc2ccccc12)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H18ClN3O2S/c22-15-8-6-14(7-9-15)17-10-11-18(27-17)21(26)24-13-3-12-23-20-16-4-1-2-5-19(16)28-25-20/h1-2,4-11H,3,12-13H2,(H,23,25)(H,24,26) |
| InChIKey | ADABBFRXISAQSA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide?
The IUPAC name of N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide (CID 57436491) is N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide.
What is the SMILES notation for N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide?
The canonical SMILES for N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide is O=C(NCCCNc1nsc2ccccc12)c1ccc(-c2ccc(Cl)cc2)o1.
What is the InChIKey of N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide?
The InChIKey is ADABBFRXISAQSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClN3O2S/c22-15-8-6-14(7-9-15)17-10-11-18(27-17)21(26)24-13-3-12-23-20-16-4-1-2-5-19(16)28-25-20/h1-2,4-11H,3,12-13H2,(H,23,25)(H,24,26).
What are the key properties of N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide?
N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide has a molecular weight of 411.91 g/mol, XLogP of 5.44, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,2-benzothiazol-3-ylamino)propyl]-5-(4-chlorophenyl)furan-2-carboxamide is sourced from PubChem (CID 57436491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).