C14H16F3NO4S — CID 57436798
2-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-2-yl]acetic acid (PubChem CID 57436798) has the molecular formula C14H16F3NO4S and a molecular weight of 351.35 g/mol. Its IUPAC name is 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 57436798 |
| Molecular Formula | C14H16F3NO4S |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCCN1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO4S/c15-14(16,17)10-4-3-6-12(8-10)23(21,22)18-7-2-1-5-11(18)9-13(19)20/h3-4,6,8,11H,1-2,5,7,9H2,(H,19,20) |
| InChIKey | ZJTCVCIRHVPNAR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |