About 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid
3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid (PubChem CID 57437428) has the molecular formula C12H16O3S
and a molecular weight of 240.32 g/mol. Its IUPAC name is 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid |
| PubChem CID | 57437428 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid |
| SMILES | COc1sc(C(=O)O)c2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C12H16O3S/c1-12(2)5-4-7-8(6-12)11(15-3)16-9(7)10(13)14/h4-6H2,1-3H3,(H,13,14) |
| InChIKey | CQSPMBBTEZSULR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid?
The IUPAC name of 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid (CID 57437428) is 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid.
What is the SMILES notation for 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid?
The canonical SMILES for 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid is COc1sc(C(=O)O)c2c1CC(C)(C)CC2.
What is the InChIKey of 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid?
The InChIKey is CQSPMBBTEZSULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3S/c1-12(2)5-4-7-8(6-12)11(15-3)16-9(7)10(13)14/h4-6H2,1-3H3,(H,13,14).
What are the key properties of 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid?
3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid has a molecular weight of 240.32 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,5-dimethyl-6,7-dihydro-4H-2-benzothiophene-1-carboxylic acid is sourced from PubChem (CID 57437428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).