About ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate
ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 57437564) has the molecular formula C14H15Cl2NO3
and a molecular weight of 316.18 g/mol. Its IUPAC name is ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate |
| PubChem CID | 57437564 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CC(Cc2ccc(Cl)c(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C14H15Cl2NO3/c1-2-20-14(19)12-7-9(13(18)17-12)5-8-3-4-10(15)11(16)6-8/h3-4,6,9,12H,2,5,7H2,1H3,(H,17,18) |
| InChIKey | CBFKBZHQIIZLHS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate?
The IUPAC name of ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate (CID 57437564) is ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate.
What is the SMILES notation for ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate?
The canonical SMILES for ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate is CCOC(=O)C1CC(Cc2ccc(Cl)c(Cl)c2)C(=O)N1.
What is the InChIKey of ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate?
The InChIKey is CBFKBZHQIIZLHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO3/c1-2-20-14(19)12-7-9(13(18)17-12)5-8-3-4-10(15)11(16)6-8/h3-4,6,9,12H,2,5,7H2,1H3,(H,17,18).
What are the key properties of ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate?
ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate has a molecular weight of 316.18 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxylate is sourced from PubChem (CID 57437564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).