C13H5F7N4O3S — CID 57438077
[2-fluoro-5-[3-(trifluoromethyl)imidazo[1,2-b][1,2,4]triazin-7-yl]phenyl] trifluoromethanesulfonate (PubChem CID 57438077) has the molecular formula C13H5F7N4O3S and a molecular weight of 430.26 g/mol. Its IUPAC name is [2-fluoro-5-[3-(trifluoromethyl)imidazo[1,2-b][1,2,4]triazin-7-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-fluoro-5-[3-(trifluoromethyl)imidazo[1,2-b][1,2,4]triazin-7-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57438077 |
| Molecular Formula | C13H5F7N4O3S |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | [2-fluoro-5-[3-(trifluoromethyl)imidazo[1,2-b][1,2,4]triazin-7-yl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(-c2cnc3nc(C(F)(F)F)cnn23)ccc1F)C(F)(F)F |
| InChI | InChI=1S/C13H5F7N4O3S/c14-7-2-1-6(3-9(7)27-28(25,26)13(18,19)20)8-4-21-11-23-10(12(15,16)17)5-22-24(8)11/h1-5H |
| InChIKey | UNMGYCJAYWILIW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|