About 1,4,5-trimethyltetrazaborole
1,4,5-trimethyltetrazaborole (PubChem CID 574388) has the molecular formula C3H9BN4
and a molecular weight of 111.94 g/mol. Its IUPAC name is 1,4,5-trimethyltetrazaborole.
Molecular Properties
| Compound Name | 1,4,5-trimethyltetrazaborole |
| PubChem CID | 574388 |
| Molecular Formula | C3H9BN4 |
| Molecular Weight | 111.94 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 1,4,5-trimethyltetrazaborole |
| SMILES | CB1N(C)N=NN1C |
| InChI | InChI=1S/C3H9BN4/c1-4-7(2)5-6-8(4)3/h1-3H3 |
| InChIKey | DFAXTGNYQWFIBM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.94 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,4,5-trimethyltetrazaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5-trimethyltetrazaborole?
The IUPAC name of 1,4,5-trimethyltetrazaborole (CID 574388) is 1,4,5-trimethyltetrazaborole.
What is the SMILES notation for 1,4,5-trimethyltetrazaborole?
The canonical SMILES for 1,4,5-trimethyltetrazaborole is CB1N(C)N=NN1C.
What is the InChIKey of 1,4,5-trimethyltetrazaborole?
The InChIKey is DFAXTGNYQWFIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9BN4/c1-4-7(2)5-6-8(4)3/h1-3H3.
What are the key properties of 1,4,5-trimethyltetrazaborole?
1,4,5-trimethyltetrazaborole has a molecular weight of 111.94 g/mol, XLogP of 0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5-trimethyltetrazaborole is sourced from PubChem (CID 574388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).