About (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol
(2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol (PubChem CID 57438884) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol.
Molecular Properties
| Compound Name | (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol |
| PubChem CID | 57438884 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol |
| SMILES | C#CC[C@@H](O)[C@@H](CO)[C@H](C=C)OCOC |
| InChI | InChI=1S/C11H18O4/c1-4-6-10(13)9(7-12)11(5-2)15-8-14-3/h1,5,9-13H,2,6-8H2,3H3/t9-,10-,11+/m1/s1 |
| InChIKey | WSRQNCHAEFZKGK-MXWKQRLJSA-N |
| XLogP | 0.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol?
The IUPAC name of (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol (CID 57438884) is (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol.
What is the SMILES notation for (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol?
The canonical SMILES for (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol is C#CC[C@@H](O)[C@@H](CO)[C@H](C=C)OCOC.
What is the InChIKey of (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol?
The InChIKey is WSRQNCHAEFZKGK-MXWKQRLJSA-N. The full InChI is InChI=1S/C11H18O4/c1-4-6-10(13)9(7-12)11(5-2)15-8-14-3/h1,5,9-13H,2,6-8H2,3H3/t9-,10-,11+/m1/s1.
What are the key properties of (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol?
(2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol has a molecular weight of 214.26 g/mol, XLogP of 0.15, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-[(1S)-1-(methoxymethoxy)prop-2-enyl]hex-5-yne-1,3-diol is sourced from PubChem (CID 57438884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).