C14H22O4 — CID 57438885
[(2R,3R)-3-hydroxy-2-[(1S)-1-hydroxyprop-2-enyl]hex-5-ynyl] 2,2-dimethylpropanoate (PubChem CID 57438885) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is [(2R,3R)-3-hydroxy-2-[(1S)-1-hydroxyprop-2-enyl]hex-5-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R)-3-hydroxy-2-[(1S)-1-hydroxyprop-2-enyl]hex-5-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57438885 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [(2R,3R)-3-hydroxy-2-[(1S)-1-hydroxyprop-2-enyl]hex-5-ynyl] 2,2-dimethylpropanoate |
| SMILES | C#CC[C@@H](O)[C@@H](COC(=O)C(C)(C)C)[C@@H](O)C=C |
| InChI | InChI=1S/C14H22O4/c1-6-8-12(16)10(11(15)7-2)9-18-13(17)14(3,4)5/h1,7,10-12,15-16H,2,8-9H2,3-5H3/t10-,11-,12+/m0/s1 |
| InChIKey | IQXDVUVVSSERAD-SDDRHHMPSA-N |
| XLogP | 1.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|