About 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one
2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 57439966) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one.
Molecular Properties
| Compound Name | 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one |
| PubChem CID | 57439966 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(c2ccncc2)CCC12CCCNC2 |
| InChI | InChI=1S/C13H17N3O/c17-12-13(4-1-6-15-10-13)5-9-16(12)11-2-7-14-8-3-11/h2-3,7-8,15H,1,4-6,9-10H2 |
| InChIKey | IKNLVLLNGGCJLI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one?
The IUPAC name of 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one (CID 57439966) is 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one.
What is the SMILES notation for 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one?
The canonical SMILES for 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one is O=C1N(c2ccncc2)CCC12CCCNC2.
What is the InChIKey of 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one?
The InChIKey is IKNLVLLNGGCJLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c17-12-13(4-1-6-15-10-13)5-9-16(12)11-2-7-14-8-3-11/h2-3,7-8,15H,1,4-6,9-10H2.
What are the key properties of 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one?
2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one has a molecular weight of 231.30 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-4-yl-2,9-diazaspiro[4.5]decan-1-one is sourced from PubChem (CID 57439966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).