About CID 57440013
CID 57440013 (PubChem CID 57440013) has the molecular formula C9H6NS
and a molecular weight of 160.22 g/mol.
Molecular Properties
| Compound Name | CID 57440013 |
| PubChem CID | 57440013 |
| Molecular Formula | C9H6NS |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | — |
| SMILES | [c]1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H6NS/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-5,7H |
| InChIKey | ODLGIUMZMIWVOM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 57440013 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57440013?
The IUPAC name of CID 57440013 (CID 57440013) is not available.
What is the SMILES notation for CID 57440013?
The canonical SMILES for CID 57440013 is [c]1csc(-c2ccccc2)n1.
What is the InChIKey of CID 57440013?
The InChIKey is ODLGIUMZMIWVOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6NS/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-5,7H.
What are the key properties of CID 57440013?
CID 57440013 has a molecular weight of 160.22 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57440013 is sourced from PubChem (CID 57440013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).