C6H2F3N3OS — CID 57440769
N-(5-cyano-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 57440769) has the molecular formula C6H2F3N3OS and a molecular weight of 221.16 g/mol. Its IUPAC name is N-(5-cyano-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(5-cyano-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 57440769 |
| Molecular Formula | C6H2F3N3OS |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | N-(5-cyano-1,3-thiazol-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | N#Cc1cnc(NC(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C6H2F3N3OS/c7-6(8,9)4(13)12-5-11-2-3(1-10)14-5/h2H,(H,11,12,13) |
| InChIKey | ZLYYWPLYZWIANU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |