About cyclobutene-1-sulfinate
cyclobutene-1-sulfinate (PubChem CID 57440961) has the molecular formula C4H5O2S-
and a molecular weight of 117.15 g/mol. Its IUPAC name is cyclobutene-1-sulfinate.
Molecular Properties
| Compound Name | cyclobutene-1-sulfinate |
| PubChem CID | 57440961 |
| Molecular Formula | C4H5O2S- |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.00 |
| IUPAC Name | cyclobutene-1-sulfinate |
| SMILES | O=S([O-])C1=CCC1 |
| InChI | InChI=1S/C4H6O2S/c5-7(6)4-2-1-3-4/h2H,1,3H2,(H,5,6)/p-1 |
| InChIKey | JDADFFDRAAYRQD-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze cyclobutene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutene-1-sulfinate?
The IUPAC name of cyclobutene-1-sulfinate (CID 57440961) is cyclobutene-1-sulfinate.
What is the SMILES notation for cyclobutene-1-sulfinate?
The canonical SMILES for cyclobutene-1-sulfinate is O=S([O-])C1=CCC1.
What is the InChIKey of cyclobutene-1-sulfinate?
The InChIKey is JDADFFDRAAYRQD-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O2S/c5-7(6)4-2-1-3-4/h2H,1,3H2,(H,5,6)/p-1.
What are the key properties of cyclobutene-1-sulfinate?
cyclobutene-1-sulfinate has a molecular weight of 117.15 g/mol, XLogP of 0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutene-1-sulfinate is sourced from PubChem (CID 57440961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).