About oxirane-2-sulfinate
oxirane-2-sulfinate (PubChem CID 57440964) has the molecular formula C2H3O3S-
and a molecular weight of 107.11 g/mol. Its IUPAC name is oxirane-2-sulfinate.
Molecular Properties
| Compound Name | oxirane-2-sulfinate |
| PubChem CID | 57440964 |
| Molecular Formula | C2H3O3S- |
| Molecular Weight | 107.11 g/mol |
| Exact Mass | 106.98 |
| IUPAC Name | oxirane-2-sulfinate |
| SMILES | O=S([O-])C1CO1 |
| InChI | InChI=1S/C2H4O3S/c3-6(4)2-1-5-2/h2H,1H2,(H,3,4)/p-1 |
| InChIKey | MAMKLDLHEYLEOS-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.11 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane-2-sulfinate?
The IUPAC name of oxirane-2-sulfinate (CID 57440964) is oxirane-2-sulfinate.
What is the SMILES notation for oxirane-2-sulfinate?
The canonical SMILES for oxirane-2-sulfinate is O=S([O-])C1CO1.
What is the InChIKey of oxirane-2-sulfinate?
The InChIKey is MAMKLDLHEYLEOS-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O3S/c3-6(4)2-1-5-2/h2H,1H2,(H,3,4)/p-1.
What are the key properties of oxirane-2-sulfinate?
oxirane-2-sulfinate has a molecular weight of 107.11 g/mol, XLogP of -0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane-2-sulfinate is sourced from PubChem (CID 57440964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).