About (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol
(6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol (PubChem CID 57441048) has the molecular formula C7H6IN3O
and a molecular weight of 275.05 g/mol. Its IUPAC name is (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol.
Molecular Properties
| Compound Name | (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol |
| PubChem CID | 57441048 |
| Molecular Formula | C7H6IN3O |
| Molecular Weight | 275.05 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol |
| SMILES | OCc1cn2nc(I)ccc2n1 |
| InChI | InChI=1S/C7H6IN3O/c8-6-1-2-7-9-5(4-12)3-11(7)10-6/h1-3,12H,4H2 |
| InChIKey | QCSAKZBOQUMEND-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.05 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol?
The IUPAC name of (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol (CID 57441048) is (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol.
What is the SMILES notation for (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol?
The canonical SMILES for (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol is OCc1cn2nc(I)ccc2n1.
What is the InChIKey of (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol?
The InChIKey is QCSAKZBOQUMEND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6IN3O/c8-6-1-2-7-9-5(4-12)3-11(7)10-6/h1-3,12H,4H2.
What are the key properties of (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol?
(6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol has a molecular weight of 275.05 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-iodoimidazo[1,2-b]pyridazin-2-yl)methanol is sourced from PubChem (CID 57441048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).