About N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide
N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide (PubChem CID 57441073) has the molecular formula C19H27F2N3O2S
and a molecular weight of 399.51 g/mol. Its IUPAC name is N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide |
| PubChem CID | 57441073 |
| Molecular Formula | C19H27F2N3O2S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide |
| SMILES | CC(C)(C)c1nc2cc(NS(C)(=O)=O)ccc2n1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H27F2N3O2S/c1-18(2,3)17-22-15-11-14(23-27(4,25)26)5-6-16(15)24(17)12-13-7-9-19(20,21)10-8-13/h5-6,11,13,23H,7-10,12H2,1-4H3 |
| InChIKey | AQFUOGOTSXTUFN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide?
The IUPAC name of N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide (CID 57441073) is N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide.
What is the SMILES notation for N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide?
The canonical SMILES for N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide is CC(C)(C)c1nc2cc(NS(C)(=O)=O)ccc2n1CC1CCC(F)(F)CC1.
What is the InChIKey of N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide?
The InChIKey is AQFUOGOTSXTUFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27F2N3O2S/c1-18(2,3)17-22-15-11-14(23-27(4,25)26)5-6-16(15)24(17)12-13-7-9-19(20,21)10-8-13/h5-6,11,13,23H,7-10,12H2,1-4H3.
What are the key properties of N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide?
N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide has a molecular weight of 399.51 g/mol, XLogP of 4.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-tert-butyl-1-[(4,4-difluorocyclohexyl)methyl]benzimidazol-5-yl]methanesulfonamide is sourced from PubChem (CID 57441073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).