C11H16O3 — CID 574413
2,10-dimethyl-1,5-dioxaspiro[5.5]undec-2-en-4-one (PubChem CID 574413) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,10-dimethyl-1,5-dioxaspiro[5.5]undec-2-en-4-one.
| Compound Name | 2,10-dimethyl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
|---|---|
| PubChem CID | 574413 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2,10-dimethyl-1,5-dioxaspiro[5.5]undec-2-en-4-one |
| SMILES | CC1=CC(=O)OC2(CCCC(C)C2)O1 |
| InChI | InChI=1S/C11H16O3/c1-8-4-3-5-11(7-8)13-9(2)6-10(12)14-11/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | SSJNTIIARPMCNX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |