C24H28N6O3 — CID 57441868
4-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]benzamide (PubChem CID 57441868) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]benzamide.
| Compound Name | 4-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]benzamide |
|---|---|
| PubChem CID | 57441868 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]benzamide |
| SMILES | C[C@H]1COCCN1c1nc(N2CCOC[C@@H]2C)c2ccc(-c3ccc(C(N)=O)cc3)nc2n1 |
| InChI | InChI=1S/C24H28N6O3/c1-15-13-32-11-9-29(15)23-19-7-8-20(17-3-5-18(6-4-17)21(25)31)26-22(19)27-24(28-23)30-10-12-33-14-16(30)2/h3-8,15-16H,9-14H2,1-2H3,(H2,25,31)/t15-,16-/m0/s1 |
| InChIKey | ZSFZYLMPKBDJKI-HOTGVXAUSA-N |
| XLogP | 2.24 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |