C27H34N6O4 — CID 57441879
3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 57441879) has the molecular formula C27H34N6O4 and a molecular weight of 506.61 g/mol. Its IUPAC name is 3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 57441879 |
| Molecular Formula | C27H34N6O4 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)c1 |
| InChI | InChI=1S/C27H34N6O4/c1-18-16-36-13-10-32(18)25-22-7-8-23(20-5-4-6-21(15-20)26(34)28-9-12-35-3)29-24(22)30-27(31-25)33-11-14-37-17-19(33)2/h4-8,15,18-19H,9-14,16-17H2,1-3H3,(H,28,34)/t18-,19-/m0/s1 |
| InChIKey | MAJSWWGKAQQBGE-OALUTQOASA-N |
| XLogP | 2.52 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|