C24H27FN6O3 — CID 57441909
4-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-fluorobenzamide (PubChem CID 57441909) has the molecular formula C24H27FN6O3 and a molecular weight of 466.52 g/mol. Its IUPAC name is 4-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-fluorobenzamide.
| Compound Name | 4-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 57441909 |
| Molecular Formula | C24H27FN6O3 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 4-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-fluorobenzamide |
| SMILES | C[C@H]1COCCN1c1nc(N2CCOC[C@@H]2C)c2ccc(-c3ccc(C(N)=O)c(F)c3)nc2n1 |
| InChI | InChI=1S/C24H27FN6O3/c1-14-12-33-9-7-30(14)23-18-5-6-20(16-3-4-17(21(26)32)19(25)11-16)27-22(18)28-24(29-23)31-8-10-34-13-15(31)2/h3-6,11,14-15H,7-10,12-13H2,1-2H3,(H2,26,32)/t14-,15-/m0/s1 |
| InChIKey | DLQYCADNMGPWLT-GJZGRUSLSA-N |
| XLogP | 2.38 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |